C19H24ClN7OS — CID 135257097
N'-[6-[(2-amino-3-chloro-4-pyridinyl)sulfanyl]-3-[(3S)-3-methyl-2-oxa-8-azaspiro[4.5]decan-8-yl]pyrazin-2-yl]methanimidamide (PubChem CID 135257097) has the molecular formula C19H24ClN7OS and a molecular weight of 433.97 g/mol. Its IUPAC name is N'-[6-[(2-amino-3-chloro-4-pyridinyl)sulfanyl]-3-[(3S)-3-methyl-2-oxa-8-azaspiro[4.5]decan-8-yl]pyrazin-2-yl]methanimidamide.
| Compound Name | N'-[6-[(2-amino-3-chloro-4-pyridinyl)sulfanyl]-3-[(3S)-3-methyl-2-oxa-8-azaspiro[4.5]decan-8-yl]pyrazin-2-yl]methanimidamide |
|---|---|
| PubChem CID | 135257097 |
| Molecular Formula | C19H24ClN7OS |
| Molecular Weight | 433.97 g/mol |
| Exact Mass | 433.15 |
| IUPAC Name | N'-[6-[(2-amino-3-chloro-4-pyridinyl)sulfanyl]-3-[(3S)-3-methyl-2-oxa-8-azaspiro[4.5]decan-8-yl]pyrazin-2-yl]methanimidamide |
| SMILES | C[C@H]1CC2(CCN(c3ncc(Sc4ccnc(N)c4Cl)nc3/N=C/N)CC2)CO1 |
| InChI | InChI=1S/C19H24ClN7OS/c1-12-8-19(10-28-12)3-6-27(7-4-19)18-17(25-11-21)26-14(9-24-18)29-13-2-5-23-16(22)15(13)20/h2,5,9,11-12H,3-4,6-8,10H2,1H3,(H2,22,23)(H2,21,25,26)/t12-/m0/s1 |
| InChIKey | ISSNFYWTPFTRJG-LBPRGKRZSA-N |
| XLogP | 3.27 |
| TPSA | 115.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.97 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|