C8H11F2N3O2 — CID 135257213
(5S)-6,6-difluoro-8-methyl-1,3,8-triazaspiro[4.5]decane-2,4-dione (PubChem CID 135257213) has the molecular formula C8H11F2N3O2 and a molecular weight of 219.19 g/mol. Its IUPAC name is (5S)-6,6-difluoro-8-methyl-1,3,8-triazaspiro[4.5]decane-2,4-dione.
| Compound Name | (5S)-6,6-difluoro-8-methyl-1,3,8-triazaspiro[4.5]decane-2,4-dione |
|---|---|
| PubChem CID | 135257213 |
| Molecular Formula | C8H11F2N3O2 |
| Molecular Weight | 219.19 g/mol |
| Exact Mass | 219.08 |
| IUPAC Name | (5S)-6,6-difluoro-8-methyl-1,3,8-triazaspiro[4.5]decane-2,4-dione |
| SMILES | CN1CC[C@@]2(NC(=O)NC2=O)C(F)(F)C1 |
| InChI | InChI=1S/C8H11F2N3O2/c1-13-3-2-7(8(9,10)4-13)5(14)11-6(15)12-7/h2-4H2,1H3,(H2,11,12,14,15)/t7-/m0/s1 |
| InChIKey | LHFWXKLLWNCDIH-ZETCQYMHSA-N |
| XLogP | -0.46 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.19 |
| LogP ≤ 5 | -0.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|