C30H28F5N3O6S — CID 135257576
methyl 4-[(5-cyclohexyl-2-pyridinyl)methyl-[(2R)-1-(2,3,4,5,6-pentafluorophenyl)sulfonylazetidine-2-carbonyl]amino]-2-hydroxybenzoate (PubChem CID 135257576) has the molecular formula C30H28F5N3O6S and a molecular weight of 653.63 g/mol. Its IUPAC name is methyl 4-[(5-cyclohexyl-2-pyridinyl)methyl-[(2R)-1-(2,3,4,5,6-pentafluorophenyl)sulfonylazetidine-2-carbonyl]amino]-2-hydroxybenzoate.
| Compound Name | methyl 4-[(5-cyclohexyl-2-pyridinyl)methyl-[(2R)-1-(2,3,4,5,6-pentafluorophenyl)sulfonylazetidine-2-carbonyl]amino]-2-hydroxybenzoate |
|---|---|
| PubChem CID | 135257576 |
| Molecular Formula | C30H28F5N3O6S |
| Molecular Weight | 653.63 g/mol |
| Exact Mass | 653.16 |
| IUPAC Name | methyl 4-[(5-cyclohexyl-2-pyridinyl)methyl-[(2R)-1-(2,3,4,5,6-pentafluorophenyl)sulfonylazetidine-2-carbonyl]amino]-2-hydroxybenzoate |
| SMILES | COC(=O)c1ccc(N(Cc2ccc(C3CCCCC3)cn2)C(=O)[C@H]2CCN2S(=O)(=O)c2c(F)c(F)c(F)c(F)c2F)cc1O |
| InChI | InChI=1S/C30H28F5N3O6S/c1-44-30(41)20-10-9-19(13-22(20)39)37(15-18-8-7-17(14-36-18)16-5-3-2-4-6-16)29(40)21-11-12-38(21)45(42,43)28-26(34)24(32)23(31)25(33)27(28)35/h7-10,13-14,16,21,39H,2-6,11-12,15H2,1H3/t21-/m1/s1 |
| InChIKey | ZLKJOAVWPJXSFD-OAQYLSRUSA-N |
| XLogP | 5.31 |
| TPSA | 117.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 653.63 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|