C21H22F5NO5S — CID 135257596
tert-butyl (2S)-2-[(2,3,4,5,6-pentafluorophenyl)sulfonylamino]-4-phenylmethoxybutanoate (PubChem CID 135257596) has the molecular formula C21H22F5NO5S and a molecular weight of 495.47 g/mol. Its IUPAC name is tert-butyl (2S)-2-[(2,3,4,5,6-pentafluorophenyl)sulfonylamino]-4-phenylmethoxybutanoate.
| Compound Name | tert-butyl (2S)-2-[(2,3,4,5,6-pentafluorophenyl)sulfonylamino]-4-phenylmethoxybutanoate |
|---|---|
| PubChem CID | 135257596 |
| Molecular Formula | C21H22F5NO5S |
| Molecular Weight | 495.47 g/mol |
| Exact Mass | 495.11 |
| IUPAC Name | tert-butyl (2S)-2-[(2,3,4,5,6-pentafluorophenyl)sulfonylamino]-4-phenylmethoxybutanoate |
| SMILES | CC(C)(C)OC(=O)[C@H](CCOCc1ccccc1)NS(=O)(=O)c1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C21H22F5NO5S/c1-21(2,3)32-20(28)13(9-10-31-11-12-7-5-4-6-8-12)27-33(29,30)19-17(25)15(23)14(22)16(24)18(19)26/h4-8,13,27H,9-11H2,1-3H3/t13-/m0/s1 |
| InChIKey | CXQRGUZZDIIXKT-ZDUSSCGKSA-N |
| XLogP | 3.98 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.47 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|