C28H24F5N3O6S — CID 135257687
4-[(5-cyclopentyl-2-pyridinyl)methyl-[(2R)-1-(2,3,4,5,6-pentafluorophenyl)sulfonylazetidine-2-carbonyl]amino]-2-hydroxybenzoic acid (PubChem CID 135257687) has the molecular formula C28H24F5N3O6S and a molecular weight of 625.57 g/mol. Its IUPAC name is 4-[(5-cyclopentyl-2-pyridinyl)methyl-[(2R)-1-(2,3,4,5,6-pentafluorophenyl)sulfonylazetidine-2-carbonyl]amino]-2-hydroxybenzoic acid.
| Compound Name | 4-[(5-cyclopentyl-2-pyridinyl)methyl-[(2R)-1-(2,3,4,5,6-pentafluorophenyl)sulfonylazetidine-2-carbonyl]amino]-2-hydroxybenzoic acid |
|---|---|
| PubChem CID | 135257687 |
| Molecular Formula | C28H24F5N3O6S |
| Molecular Weight | 625.57 g/mol |
| Exact Mass | 625.13 |
| IUPAC Name | 4-[(5-cyclopentyl-2-pyridinyl)methyl-[(2R)-1-(2,3,4,5,6-pentafluorophenyl)sulfonylazetidine-2-carbonyl]amino]-2-hydroxybenzoic acid |
| SMILES | O=C(O)c1ccc(N(Cc2ccc(C3CCCC3)cn2)C(=O)[C@H]2CCN2S(=O)(=O)c2c(F)c(F)c(F)c(F)c2F)cc1O |
| InChI | InChI=1S/C28H24F5N3O6S/c29-21-22(30)24(32)26(25(33)23(21)31)43(41,42)36-10-9-19(36)27(38)35(17-7-8-18(28(39)40)20(37)11-17)13-16-6-5-15(12-34-16)14-3-1-2-4-14/h5-8,11-12,14,19,37H,1-4,9-10,13H2,(H,39,40)/t19-/m1/s1 |
| InChIKey | RXWCTVCORFDIBA-LJQANCHMSA-N |
| XLogP | 4.83 |
| TPSA | 128.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 625.57 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|