C27H23F5N4O6S — CID 135257898
4-[(5-cyclopentylpyrazin-2-yl)methyl-[(2R)-1-(2,3,4,5,6-pentafluorophenyl)sulfonylazetidine-2-carbonyl]amino]-2-hydroxybenzoic acid (PubChem CID 135257898) has the molecular formula C27H23F5N4O6S and a molecular weight of 626.56 g/mol. Its IUPAC name is 4-[(5-cyclopentylpyrazin-2-yl)methyl-[(2R)-1-(2,3,4,5,6-pentafluorophenyl)sulfonylazetidine-2-carbonyl]amino]-2-hydroxybenzoic acid.
| Compound Name | 4-[(5-cyclopentylpyrazin-2-yl)methyl-[(2R)-1-(2,3,4,5,6-pentafluorophenyl)sulfonylazetidine-2-carbonyl]amino]-2-hydroxybenzoic acid |
|---|---|
| PubChem CID | 135257898 |
| Molecular Formula | C27H23F5N4O6S |
| Molecular Weight | 626.56 g/mol |
| Exact Mass | 626.13 |
| IUPAC Name | 4-[(5-cyclopentylpyrazin-2-yl)methyl-[(2R)-1-(2,3,4,5,6-pentafluorophenyl)sulfonylazetidine-2-carbonyl]amino]-2-hydroxybenzoic acid |
| SMILES | O=C(O)c1ccc(N(Cc2cnc(C3CCCC3)cn2)C(=O)[C@H]2CCN2S(=O)(=O)c2c(F)c(F)c(F)c(F)c2F)cc1O |
| InChI | InChI=1S/C27H23F5N4O6S/c28-20-21(29)23(31)25(24(32)22(20)30)43(41,42)36-8-7-18(36)26(38)35(15-5-6-16(27(39)40)19(37)9-15)12-14-10-34-17(11-33-14)13-3-1-2-4-13/h5-6,9-11,13,18,37H,1-4,7-8,12H2,(H,39,40)/t18-/m1/s1 |
| InChIKey | OZWUNMGRFHTKNB-GOSISDBHSA-N |
| XLogP | 4.23 |
| TPSA | 141.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.56 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|