About 3-(cyclohepta-1,3,6-trien-1-ylmethyl)-6-methyl-4H-pyrimidine
3-(cyclohepta-1,3,6-trien-1-ylmethyl)-6-methyl-4H-pyrimidine (PubChem CID 135258687) has the molecular formula C13H16N2
and a molecular weight of 200.28 g/mol. Its IUPAC name is 3-(cyclohepta-1,3,6-trien-1-ylmethyl)-6-methyl-4H-pyrimidine.
Molecular Properties
| Compound Name | 3-(cyclohepta-1,3,6-trien-1-ylmethyl)-6-methyl-4H-pyrimidine |
| PubChem CID | 135258687 |
| Molecular Formula | C13H16N2 |
| Molecular Weight | 200.28 g/mol |
| Exact Mass | 200.13 |
| IUPAC Name | 3-(cyclohepta-1,3,6-trien-1-ylmethyl)-6-methyl-4H-pyrimidine |
| SMILES | CC1=CCN(CC2=CC=CCC=C2)C=N1 |
| InChI | InChI=1S/C13H16N2/c1-12-8-9-15(11-14-12)10-13-6-4-2-3-5-7-13/h2,4-8,11H,3,9-10H2,1H3 |
| InChIKey | HEQAFIIMLFCIFQ-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.28 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-(cyclohepta-1,3,6-trien-1-ylmethyl)-6-methyl-4H-pyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(cyclohepta-1,3,6-trien-1-ylmethyl)-6-methyl-4H-pyrimidine?
The IUPAC name of 3-(cyclohepta-1,3,6-trien-1-ylmethyl)-6-methyl-4H-pyrimidine (CID 135258687) is 3-(cyclohepta-1,3,6-trien-1-ylmethyl)-6-methyl-4H-pyrimidine.
What is the SMILES notation for 3-(cyclohepta-1,3,6-trien-1-ylmethyl)-6-methyl-4H-pyrimidine?
The canonical SMILES for 3-(cyclohepta-1,3,6-trien-1-ylmethyl)-6-methyl-4H-pyrimidine is CC1=CCN(CC2=CC=CCC=C2)C=N1.
What is the InChIKey of 3-(cyclohepta-1,3,6-trien-1-ylmethyl)-6-methyl-4H-pyrimidine?
The InChIKey is HEQAFIIMLFCIFQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H16N2/c1-12-8-9-15(11-14-12)10-13-6-4-2-3-5-7-13/h2,4-8,11H,3,9-10H2,1H3.
What are the key properties of 3-(cyclohepta-1,3,6-trien-1-ylmethyl)-6-methyl-4H-pyrimidine?
3-(cyclohepta-1,3,6-trien-1-ylmethyl)-6-methyl-4H-pyrimidine has a molecular weight of 200.28 g/mol, XLogP of 2.68, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(cyclohepta-1,3,6-trien-1-ylmethyl)-6-methyl-4H-pyrimidine is sourced from PubChem (CID 135258687), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).