C21H17NO2 — CID 135258757
2-[(E)-2-[(1Z)-buta-1,3-dienoxy]ethenyl]-4,5-diphenyl-1,3-oxazole (PubChem CID 135258757) has the molecular formula C21H17NO2 and a molecular weight of 315.37 g/mol. Its IUPAC name is 2-[(E)-2-[(1Z)-buta-1,3-dienoxy]ethenyl]-4,5-diphenyl-1,3-oxazole.
| Compound Name | 2-[(E)-2-[(1Z)-buta-1,3-dienoxy]ethenyl]-4,5-diphenyl-1,3-oxazole |
|---|---|
| PubChem CID | 135258757 |
| Molecular Formula | C21H17NO2 |
| Molecular Weight | 315.37 g/mol |
| Exact Mass | 315.13 |
| IUPAC Name | 2-[(E)-2-[(1Z)-buta-1,3-dienoxy]ethenyl]-4,5-diphenyl-1,3-oxazole |
| SMILES | C=C/C=C\O/C=C/c1nc(-c2ccccc2)c(-c2ccccc2)o1 |
| InChI | InChI=1S/C21H17NO2/c1-2-3-15-23-16-14-19-22-20(17-10-6-4-7-11-17)21(24-19)18-12-8-5-9-13-18/h2-16H,1H2/b15-3-,16-14+ |
| InChIKey | OWXGRRZMCFWIIB-CZLDVJOXSA-N |
| XLogP | 5.70 |
| TPSA | 35.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.37 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|