C20H23N5O2S — CID 135259093
(E,4Z)-4-(4-methyl-2-oxo-1,4-diazaspiro[4.5]decan-3-ylidene)-2-(thieno[2,3-d]pyrimidin-4-ylamino)pent-2-enal (PubChem CID 135259093) has the molecular formula C20H23N5O2S and a molecular weight of 397.50 g/mol. Its IUPAC name is (E,4Z)-4-(4-methyl-2-oxo-1,4-diazaspiro[4.5]decan-3-ylidene)-2-(thieno[2,3-d]pyrimidin-4-ylamino)pent-2-enal.
| Compound Name | (E,4Z)-4-(4-methyl-2-oxo-1,4-diazaspiro[4.5]decan-3-ylidene)-2-(thieno[2,3-d]pyrimidin-4-ylamino)pent-2-enal |
|---|---|
| PubChem CID | 135259093 |
| Molecular Formula | C20H23N5O2S |
| Molecular Weight | 397.50 g/mol |
| Exact Mass | 397.16 |
| IUPAC Name | (E,4Z)-4-(4-methyl-2-oxo-1,4-diazaspiro[4.5]decan-3-ylidene)-2-(thieno[2,3-d]pyrimidin-4-ylamino)pent-2-enal |
| SMILES | CC(/C=C(\C=O)Nc1ncnc2sccc12)=C1\C(=O)NC2(CCCCC2)N1C |
| InChI | InChI=1S/C20H23N5O2S/c1-13(16-18(27)24-20(25(16)2)7-4-3-5-8-20)10-14(11-26)23-17-15-6-9-28-19(15)22-12-21-17/h6,9-12H,3-5,7-8H2,1-2H3,(H,24,27)(H,21,22,23)/b14-10+,16-13- |
| InChIKey | BDICBPKXIFSPIW-RGAGSJCWSA-N |
| XLogP | 3.18 |
| TPSA | 87.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.50 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|