About 7-methyl-7,8-dihydroquinazolin-4-amine
7-methyl-7,8-dihydroquinazolin-4-amine (PubChem CID 135259181) has the molecular formula C9H11N3
and a molecular weight of 161.21 g/mol. Its IUPAC name is 7-methyl-7,8-dihydroquinazolin-4-amine.
Molecular Properties
| Compound Name | 7-methyl-7,8-dihydroquinazolin-4-amine |
| PubChem CID | 135259181 |
| Molecular Formula | C9H11N3 |
| Molecular Weight | 161.21 g/mol |
| Exact Mass | 161.10 |
| IUPAC Name | 7-methyl-7,8-dihydroquinazolin-4-amine |
| SMILES | CC1C=Cc2c(N)ncnc2C1 |
| InChI | InChI=1S/C9H11N3/c1-6-2-3-7-8(4-6)11-5-12-9(7)10/h2-3,5-6H,4H2,1H3,(H2,10,11,12) |
| InChIKey | SWVLWXHNQFIYMM-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 161.21 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 7-methyl-7,8-dihydroquinazolin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-methyl-7,8-dihydroquinazolin-4-amine?
The IUPAC name of 7-methyl-7,8-dihydroquinazolin-4-amine (CID 135259181) is 7-methyl-7,8-dihydroquinazolin-4-amine.
What is the SMILES notation for 7-methyl-7,8-dihydroquinazolin-4-amine?
The canonical SMILES for 7-methyl-7,8-dihydroquinazolin-4-amine is CC1C=Cc2c(N)ncnc2C1.
What is the InChIKey of 7-methyl-7,8-dihydroquinazolin-4-amine?
The InChIKey is SWVLWXHNQFIYMM-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11N3/c1-6-2-3-7-8(4-6)11-5-12-9(7)10/h2-3,5-6H,4H2,1H3,(H2,10,11,12).
What are the key properties of 7-methyl-7,8-dihydroquinazolin-4-amine?
7-methyl-7,8-dihydroquinazolin-4-amine has a molecular weight of 161.21 g/mol, XLogP of 1.26, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 7-methyl-7,8-dihydroquinazolin-4-amine is sourced from PubChem (CID 135259181), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).