About 5-(4-aminobutyl)-4-N-butyl-6-phenylpyrimidine-2,4-diamine;dihydrochloride
5-(4-aminobutyl)-4-N-butyl-6-phenylpyrimidine-2,4-diamine;dihydrochloride (PubChem CID 135260402) has the molecular formula C18H29Cl2N5
and a molecular weight of 386.37 g/mol. Its IUPAC name is 5-(4-aminobutyl)-4-N-butyl-6-phenylpyrimidine-2,4-diamine;dihydrochloride.
Molecular Properties
| Compound Name | 5-(4-aminobutyl)-4-N-butyl-6-phenylpyrimidine-2,4-diamine;dihydrochloride |
| PubChem CID | 135260402 |
| Molecular Formula | C18H29Cl2N5 |
| Molecular Weight | 386.37 g/mol |
| Exact Mass | 385.18 |
| IUPAC Name | 5-(4-aminobutyl)-4-N-butyl-6-phenylpyrimidine-2,4-diamine;dihydrochloride |
| SMILES | CCCCNc1nc(N)nc(-c2ccccc2)c1CCCCN.Cl.Cl |
| InChI | InChI=1S/C18H27N5.2ClH/c1-2-3-13-21-17-15(11-7-8-12-19)16(22-18(20)23-17)14-9-5-4-6-10-14;;/h4-6,9-10H,2-3,7-8,11-13,19H2,1H3,(H3,20,21,22,23);2*1H |
| InChIKey | AWZMSQYOXBELQK-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 89.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 386.37 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 5-(4-aminobutyl)-4-N-butyl-6-phenylpyrimidine-2,4-diamine;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(4-aminobutyl)-4-N-butyl-6-phenylpyrimidine-2,4-diamine;dihydrochloride?
The IUPAC name of 5-(4-aminobutyl)-4-N-butyl-6-phenylpyrimidine-2,4-diamine;dihydrochloride (CID 135260402) is 5-(4-aminobutyl)-4-N-butyl-6-phenylpyrimidine-2,4-diamine;dihydrochloride.
What is the SMILES notation for 5-(4-aminobutyl)-4-N-butyl-6-phenylpyrimidine-2,4-diamine;dihydrochloride?
The canonical SMILES for 5-(4-aminobutyl)-4-N-butyl-6-phenylpyrimidine-2,4-diamine;dihydrochloride is CCCCNc1nc(N)nc(-c2ccccc2)c1CCCCN.Cl.Cl.
What is the InChIKey of 5-(4-aminobutyl)-4-N-butyl-6-phenylpyrimidine-2,4-diamine;dihydrochloride?
The InChIKey is AWZMSQYOXBELQK-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H27N5.2ClH/c1-2-3-13-21-17-15(11-7-8-12-19)16(22-18(20)23-17)14-9-5-4-6-10-14;;/h4-6,9-10H,2-3,7-8,11-13,19H2,1H3,(H3,20,21,22,23);2*1H.
What are the key properties of 5-(4-aminobutyl)-4-N-butyl-6-phenylpyrimidine-2,4-diamine;dihydrochloride?
5-(4-aminobutyl)-4-N-butyl-6-phenylpyrimidine-2,4-diamine;dihydrochloride has a molecular weight of 386.37 g/mol, XLogP of 4.06, 9 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(4-aminobutyl)-4-N-butyl-6-phenylpyrimidine-2,4-diamine;dihydrochloride is sourced from PubChem (CID 135260402), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).