C13H10N2 — CID 135260670
7,13-diazatricyclo[8.5.0.01,6]pentadeca-2,4,6,8,10,12,14-heptaene (PubChem CID 135260670) has the molecular formula C13H10N2 and a molecular weight of 194.24 g/mol. Its IUPAC name is 7,13-diazatricyclo[8.5.0.01,6]pentadeca-2,4,6,8,10,12,14-heptaene.
| Compound Name | 7,13-diazatricyclo[8.5.0.01,6]pentadeca-2,4,6,8,10,12,14-heptaene |
|---|---|
| PubChem CID | 135260670 |
| Molecular Formula | C13H10N2 |
| Molecular Weight | 194.24 g/mol |
| Exact Mass | 194.08 |
| IUPAC Name | 7,13-diazatricyclo[8.5.0.01,6]pentadeca-2,4,6,8,10,12,14-heptaene |
| SMILES | C1=CC2=NC=CC3=CC=NC=CC32C=C1 |
| InChI | InChI=1S/C13H10N2/c1-2-6-13-7-10-14-8-4-11(13)5-9-15-12(13)3-1/h1-10H |
| InChIKey | JNIKBBTUHCBORX-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.24 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |