About 2-(difluoromethyl)-1,1,3,4-tetrafluorobut-2-ene
2-(difluoromethyl)-1,1,3,4-tetrafluorobut-2-ene (PubChem CID 135261981) has the molecular formula C5H4F6
and a molecular weight of 178.08 g/mol. Its IUPAC name is 2-(difluoromethyl)-1,1,3,4-tetrafluorobut-2-ene.
Molecular Properties
| Compound Name | 2-(difluoromethyl)-1,1,3,4-tetrafluorobut-2-ene |
| PubChem CID | 135261981 |
| Molecular Formula | C5H4F6 |
| Molecular Weight | 178.08 g/mol |
| Exact Mass | 178.02 |
| IUPAC Name | 2-(difluoromethyl)-1,1,3,4-tetrafluorobut-2-ene |
| SMILES | FCC(F)=C(C(F)F)C(F)F |
| InChI | InChI=1S/C5H4F6/c6-1-2(7)3(4(8)9)5(10)11/h4-5H,1H2 |
| InChIKey | GAOZKSOKSCCJCZ-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.08 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 2-(difluoromethyl)-1,1,3,4-tetrafluorobut-2-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(difluoromethyl)-1,1,3,4-tetrafluorobut-2-ene?
The IUPAC name of 2-(difluoromethyl)-1,1,3,4-tetrafluorobut-2-ene (CID 135261981) is 2-(difluoromethyl)-1,1,3,4-tetrafluorobut-2-ene.
What is the SMILES notation for 2-(difluoromethyl)-1,1,3,4-tetrafluorobut-2-ene?
The canonical SMILES for 2-(difluoromethyl)-1,1,3,4-tetrafluorobut-2-ene is FCC(F)=C(C(F)F)C(F)F.
What is the InChIKey of 2-(difluoromethyl)-1,1,3,4-tetrafluorobut-2-ene?
The InChIKey is GAOZKSOKSCCJCZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H4F6/c6-1-2(7)3(4(8)9)5(10)11/h4-5H,1H2.
What are the key properties of 2-(difluoromethyl)-1,1,3,4-tetrafluorobut-2-ene?
2-(difluoromethyl)-1,1,3,4-tetrafluorobut-2-ene has a molecular weight of 178.08 g/mol, XLogP of 2.71, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(difluoromethyl)-1,1,3,4-tetrafluorobut-2-ene is sourced from PubChem (CID 135261981), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).