C6H4F8 — CID 135262110
2,3-bis(difluoromethyl)-1,1,4,4-tetrafluorobut-2-ene (PubChem CID 135262110) has the molecular formula C6H4F8 and a molecular weight of 228.08 g/mol. Its IUPAC name is 2,3-bis(difluoromethyl)-1,1,4,4-tetrafluorobut-2-ene.
| Compound Name | 2,3-bis(difluoromethyl)-1,1,4,4-tetrafluorobut-2-ene |
|---|---|
| PubChem CID | 135262110 |
| Molecular Formula | C6H4F8 |
| Molecular Weight | 228.08 g/mol |
| Exact Mass | 228.02 |
| IUPAC Name | 2,3-bis(difluoromethyl)-1,1,4,4-tetrafluorobut-2-ene |
| SMILES | FC(F)C(=C(C(F)F)C(F)F)C(F)F |
| InChI | InChI=1S/C6H4F8/c7-3(8)1(4(9)10)2(5(11)12)6(13)14/h3-6H |
| InChIKey | SSNFESKEEQFQGP-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.08 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|