C25H26F2N8O3S — CID 135262180
4-[[2-[6-(difluoromethyl)-2-pyridinyl]pyrrolo[2,1-f][1,2,4]triazin-4-yl]amino]-N-[3-(1,1-dioxo-1,4-thiazinan-4-yl)propyl]pyridine-3-carboxamide (PubChem CID 135262180) has the molecular formula C25H26F2N8O3S and a molecular weight of 556.60 g/mol. Its IUPAC name is 4-[[2-[6-(difluoromethyl)-2-pyridinyl]pyrrolo[2,1-f][1,2,4]triazin-4-yl]amino]-N-[3-(1,1-dioxo-1,4-thiazinan-4-yl)propyl]pyridine-3-carboxamide.
| Compound Name | 4-[[2-[6-(difluoromethyl)-2-pyridinyl]pyrrolo[2,1-f][1,2,4]triazin-4-yl]amino]-N-[3-(1,1-dioxo-1,4-thiazinan-4-yl)propyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 135262180 |
| Molecular Formula | C25H26F2N8O3S |
| Molecular Weight | 556.60 g/mol |
| Exact Mass | 556.18 |
| IUPAC Name | 4-[[2-[6-(difluoromethyl)-2-pyridinyl]pyrrolo[2,1-f][1,2,4]triazin-4-yl]amino]-N-[3-(1,1-dioxo-1,4-thiazinan-4-yl)propyl]pyridine-3-carboxamide |
| SMILES | O=C(NCCCN1CCS(=O)(=O)CC1)c1cnccc1Nc1nc(-c2cccc(C(F)F)n2)nn2cccc12 |
| InChI | InChI=1S/C25H26F2N8O3S/c26-22(27)19-4-1-5-20(30-19)23-32-24(21-6-2-11-35(21)33-23)31-18-7-9-28-16-17(18)25(36)29-8-3-10-34-12-14-39(37,38)15-13-34/h1-2,4-7,9,11,16,22H,3,8,10,12-15H2,(H,29,36)(H,28,31,32,33) |
| InChIKey | MZCGAQAWJQRWGU-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 134.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.60 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|