About 2-(difluoromethyl)-1,1,4,4-tetrafluoro-3-(fluoromethyl)but-2-ene
2-(difluoromethyl)-1,1,4,4-tetrafluoro-3-(fluoromethyl)but-2-ene (PubChem CID 135262216) has the molecular formula C6H5F7
and a molecular weight of 210.09 g/mol. Its IUPAC name is 2-(difluoromethyl)-1,1,4,4-tetrafluoro-3-(fluoromethyl)but-2-ene.
Molecular Properties
| Compound Name | 2-(difluoromethyl)-1,1,4,4-tetrafluoro-3-(fluoromethyl)but-2-ene |
| PubChem CID | 135262216 |
| Molecular Formula | C6H5F7 |
| Molecular Weight | 210.09 g/mol |
| Exact Mass | 210.03 |
| IUPAC Name | 2-(difluoromethyl)-1,1,4,4-tetrafluoro-3-(fluoromethyl)but-2-ene |
| SMILES | FCC(=C(C(F)F)C(F)F)C(F)F |
| InChI | InChI=1S/C6H5F7/c7-1-2(4(8)9)3(5(10)11)6(12)13/h4-6H,1H2 |
| InChIKey | LREGMCXGBVVBEU-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.09 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-(difluoromethyl)-1,1,4,4-tetrafluoro-3-(fluoromethyl)but-2-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(difluoromethyl)-1,1,4,4-tetrafluoro-3-(fluoromethyl)but-2-ene?
The IUPAC name of 2-(difluoromethyl)-1,1,4,4-tetrafluoro-3-(fluoromethyl)but-2-ene (CID 135262216) is 2-(difluoromethyl)-1,1,4,4-tetrafluoro-3-(fluoromethyl)but-2-ene.
What is the SMILES notation for 2-(difluoromethyl)-1,1,4,4-tetrafluoro-3-(fluoromethyl)but-2-ene?
The canonical SMILES for 2-(difluoromethyl)-1,1,4,4-tetrafluoro-3-(fluoromethyl)but-2-ene is FCC(=C(C(F)F)C(F)F)C(F)F.
What is the InChIKey of 2-(difluoromethyl)-1,1,4,4-tetrafluoro-3-(fluoromethyl)but-2-ene?
The InChIKey is LREGMCXGBVVBEU-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H5F7/c7-1-2(4(8)9)3(5(10)11)6(12)13/h4-6H,1H2.
What are the key properties of 2-(difluoromethyl)-1,1,4,4-tetrafluoro-3-(fluoromethyl)but-2-ene?
2-(difluoromethyl)-1,1,4,4-tetrafluoro-3-(fluoromethyl)but-2-ene has a molecular weight of 210.09 g/mol, XLogP of 3.05, 4 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(difluoromethyl)-1,1,4,4-tetrafluoro-3-(fluoromethyl)but-2-ene is sourced from PubChem (CID 135262216), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).