C24H27N7O2 — CID 135262330
2-(6-methyl-2-pyridinyl)-N-[3-(3-morpholin-4-ylpropoxy)-4-pyridinyl]pyrrolo[2,1-f][1,2,4]triazin-4-amine (PubChem CID 135262330) has the molecular formula C24H27N7O2 and a molecular weight of 445.53 g/mol. Its IUPAC name is 2-(6-methyl-2-pyridinyl)-N-[3-(3-morpholin-4-ylpropoxy)-4-pyridinyl]pyrrolo[2,1-f][1,2,4]triazin-4-amine.
| Compound Name | 2-(6-methyl-2-pyridinyl)-N-[3-(3-morpholin-4-ylpropoxy)-4-pyridinyl]pyrrolo[2,1-f][1,2,4]triazin-4-amine |
|---|---|
| PubChem CID | 135262330 |
| Molecular Formula | C24H27N7O2 |
| Molecular Weight | 445.53 g/mol |
| Exact Mass | 445.22 |
| IUPAC Name | 2-(6-methyl-2-pyridinyl)-N-[3-(3-morpholin-4-ylpropoxy)-4-pyridinyl]pyrrolo[2,1-f][1,2,4]triazin-4-amine |
| SMILES | Cc1cccc(-c2nc(Nc3ccncc3OCCCN3CCOCC3)c3cccn3n2)n1 |
| InChI | InChI=1S/C24H27N7O2/c1-18-5-2-6-20(26-18)23-28-24(21-7-3-11-31(21)29-23)27-19-8-9-25-17-22(19)33-14-4-10-30-12-15-32-16-13-30/h2-3,5-9,11,17H,4,10,12-16H2,1H3,(H,25,27,28,29) |
| InChIKey | MOBQPEPZKOOZLN-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 89.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.53 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|