C24H26N8O3S — CID 135262406
N-[3-(1,1-dioxo-1,4-thiazinan-4-yl)propyl]-4-[(2-pyridin-2-ylpyrrolo[2,1-f][1,2,4]triazin-4-yl)amino]pyridine-3-carboxamide (PubChem CID 135262406) has the molecular formula C24H26N8O3S and a molecular weight of 506.59 g/mol. Its IUPAC name is N-[3-(1,1-dioxo-1,4-thiazinan-4-yl)propyl]-4-[(2-pyridin-2-ylpyrrolo[2,1-f][1,2,4]triazin-4-yl)amino]pyridine-3-carboxamide.
| Compound Name | N-[3-(1,1-dioxo-1,4-thiazinan-4-yl)propyl]-4-[(2-pyridin-2-ylpyrrolo[2,1-f][1,2,4]triazin-4-yl)amino]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 135262406 |
| Molecular Formula | C24H26N8O3S |
| Molecular Weight | 506.59 g/mol |
| Exact Mass | 506.18 |
| IUPAC Name | N-[3-(1,1-dioxo-1,4-thiazinan-4-yl)propyl]-4-[(2-pyridin-2-ylpyrrolo[2,1-f][1,2,4]triazin-4-yl)amino]pyridine-3-carboxamide |
| SMILES | O=C(NCCCN1CCS(=O)(=O)CC1)c1cnccc1Nc1nc(-c2ccccn2)nn2cccc12 |
| InChI | InChI=1S/C24H26N8O3S/c33-24(27-9-4-11-31-13-15-36(34,35)16-14-31)18-17-25-10-7-19(18)28-23-21-6-3-12-32(21)30-22(29-23)20-5-1-2-8-26-20/h1-3,5-8,10,12,17H,4,9,11,13-16H2,(H,27,33)(H,25,28,29,30) |
| InChIKey | DSFIORXGHSMYPI-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 134.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.59 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|