C25H29FN8O4S — CID 135262411
1-[4-[(3-fluoro-4-pyridinyl)amino]-2-(6-methoxy-2-pyridinyl)pyrrolo[2,1-f][1,2,4]triazin-5-yl]-2-[2-(4-oxido-1-oxo-1,4-thiazinan-4-ium-4-yl)ethylamino]ethanol (PubChem CID 135262411) has the molecular formula C25H29FN8O4S and a molecular weight of 556.62 g/mol. Its IUPAC name is 1-[4-[(3-fluoro-4-pyridinyl)amino]-2-(6-methoxy-2-pyridinyl)pyrrolo[2,1-f][1,2,4]triazin-5-yl]-2-[2-(4-oxido-1-oxo-1,4-thiazinan-4-ium-4-yl)ethylamino]ethanol.
| Compound Name | 1-[4-[(3-fluoro-4-pyridinyl)amino]-2-(6-methoxy-2-pyridinyl)pyrrolo[2,1-f][1,2,4]triazin-5-yl]-2-[2-(4-oxido-1-oxo-1,4-thiazinan-4-ium-4-yl)ethylamino]ethanol |
|---|---|
| PubChem CID | 135262411 |
| Molecular Formula | C25H29FN8O4S |
| Molecular Weight | 556.62 g/mol |
| Exact Mass | 556.20 |
| IUPAC Name | 1-[4-[(3-fluoro-4-pyridinyl)amino]-2-(6-methoxy-2-pyridinyl)pyrrolo[2,1-f][1,2,4]triazin-5-yl]-2-[2-(4-oxido-1-oxo-1,4-thiazinan-4-ium-4-yl)ethylamino]ethanol |
| SMILES | COc1cccc(-c2nc(Nc3ccncc3F)c3c(C(O)CNCC[N+]4([O-])CCS(=O)CC4)ccn3n2)n1 |
| InChI | InChI=1S/C25H29FN8O4S/c1-38-22-4-2-3-20(29-22)24-31-25(30-19-5-7-27-15-18(19)26)23-17(6-9-33(23)32-24)21(35)16-28-8-10-34(36)11-13-39(37)14-12-34/h2-7,9,15,21,28,35H,8,10-14,16H2,1H3,(H,27,30,31,32) |
| InChIKey | YWKXSZCPMZIFCF-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 149.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.62 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|