C18H23NO4 — CID 135262915
tert-butyl 3-[5-(2-methoxy-2-oxoethyl)indol-1-yl]propanoate (PubChem CID 135262915) has the molecular formula C18H23NO4 and a molecular weight of 317.39 g/mol. Its IUPAC name is tert-butyl 3-[5-(2-methoxy-2-oxoethyl)indol-1-yl]propanoate.
| Compound Name | tert-butyl 3-[5-(2-methoxy-2-oxoethyl)indol-1-yl]propanoate |
|---|---|
| PubChem CID | 135262915 |
| Molecular Formula | C18H23NO4 |
| Molecular Weight | 317.39 g/mol |
| Exact Mass | 317.16 |
| IUPAC Name | tert-butyl 3-[5-(2-methoxy-2-oxoethyl)indol-1-yl]propanoate |
| SMILES | COC(=O)Cc1ccc2c(ccn2CCC(=O)OC(C)(C)C)c1 |
| InChI | InChI=1S/C18H23NO4/c1-18(2,3)23-16(20)8-10-19-9-7-14-11-13(5-6-15(14)19)12-17(21)22-4/h5-7,9,11H,8,10,12H2,1-4H3 |
| InChIKey | VBQJNENSMBPQKV-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 57.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.39 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |