C14H15ClF3NO — CID 135263337
(S)-(5-methylfuran-2-yl)-[4-methyl-2-(trifluoromethyl)phenyl]methanamine;hydrochloride (PubChem CID 135263337) has the molecular formula C14H15ClF3NO and a molecular weight of 305.73 g/mol. Its IUPAC name is (S)-(5-methylfuran-2-yl)-[4-methyl-2-(trifluoromethyl)phenyl]methanamine;hydrochloride.
| Compound Name | (S)-(5-methylfuran-2-yl)-[4-methyl-2-(trifluoromethyl)phenyl]methanamine;hydrochloride |
|---|---|
| PubChem CID | 135263337 |
| Molecular Formula | C14H15ClF3NO |
| Molecular Weight | 305.73 g/mol |
| Exact Mass | 305.08 |
| IUPAC Name | (S)-(5-methylfuran-2-yl)-[4-methyl-2-(trifluoromethyl)phenyl]methanamine;hydrochloride |
| SMILES | Cc1ccc([C@H](N)c2ccc(C)o2)c(C(F)(F)F)c1.Cl |
| InChI | InChI=1S/C14H14F3NO.ClH/c1-8-3-5-10(11(7-8)14(15,16)17)13(18)12-6-4-9(2)19-12;/h3-7,13H,18H2,1-2H3;1H/t13-;/m0./s1 |
| InChIKey | GXVZFLRKDUSJRR-ZOWNYOTGSA-N |
| XLogP | 4.39 |
| TPSA | 39.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.73 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |