C14H19NO2 — CID 135263524
(2R,4aR,8aS)-2,4a,8,8-tetramethyl-7-oxo-2,3,4,8a-tetrahydrochromene-6-carbonitrile (PubChem CID 135263524) has the molecular formula C14H19NO2 and a molecular weight of 233.31 g/mol. Its IUPAC name is (2R,4aR,8aS)-2,4a,8,8-tetramethyl-7-oxo-2,3,4,8a-tetrahydrochromene-6-carbonitrile.
| Compound Name | (2R,4aR,8aS)-2,4a,8,8-tetramethyl-7-oxo-2,3,4,8a-tetrahydrochromene-6-carbonitrile |
|---|---|
| PubChem CID | 135263524 |
| Molecular Formula | C14H19NO2 |
| Molecular Weight | 233.31 g/mol |
| Exact Mass | 233.14 |
| IUPAC Name | (2R,4aR,8aS)-2,4a,8,8-tetramethyl-7-oxo-2,3,4,8a-tetrahydrochromene-6-carbonitrile |
| SMILES | C[C@@H]1CC[C@]2(C)C=C(C#N)C(=O)C(C)(C)[C@H]2O1 |
| InChI | InChI=1S/C14H19NO2/c1-9-5-6-14(4)7-10(8-15)11(16)13(2,3)12(14)17-9/h7,9,12H,5-6H2,1-4H3/t9-,12-,14-/m1/s1 |
| InChIKey | VQSGCRCLBDDVBS-GAJTVXKRSA-N |
| XLogP | 2.62 |
| TPSA | 50.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.31 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |