C16H23NO2 — CID 135263651
(2S,4aS,8aR)-2,4a-diethyl-8,8-dimethyl-7-oxo-2,3,4,8a-tetrahydrochromene-6-carbonitrile (PubChem CID 135263651) has the molecular formula C16H23NO2 and a molecular weight of 261.36 g/mol. Its IUPAC name is (2S,4aS,8aR)-2,4a-diethyl-8,8-dimethyl-7-oxo-2,3,4,8a-tetrahydrochromene-6-carbonitrile.
| Compound Name | (2S,4aS,8aR)-2,4a-diethyl-8,8-dimethyl-7-oxo-2,3,4,8a-tetrahydrochromene-6-carbonitrile |
|---|---|
| PubChem CID | 135263651 |
| Molecular Formula | C16H23NO2 |
| Molecular Weight | 261.36 g/mol |
| Exact Mass | 261.17 |
| IUPAC Name | (2S,4aS,8aR)-2,4a-diethyl-8,8-dimethyl-7-oxo-2,3,4,8a-tetrahydrochromene-6-carbonitrile |
| SMILES | CC[C@H]1CC[C@@]2(CC)C=C(C#N)C(=O)C(C)(C)[C@@H]2O1 |
| InChI | InChI=1S/C16H23NO2/c1-5-12-7-8-16(6-2)9-11(10-17)13(18)15(3,4)14(16)19-12/h9,12,14H,5-8H2,1-4H3/t12-,14-,16-/m0/s1 |
| InChIKey | BTSLAXSZQJIMGY-NOLJZWGESA-N |
| XLogP | 3.40 |
| TPSA | 50.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.36 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |