C20H23NO2 — CID 135263670
(2S,4aS,8aR)-2-benzyl-4a,8,8-trimethyl-7-oxo-2,3,4,8a-tetrahydrochromene-6-carbonitrile (PubChem CID 135263670) has the molecular formula C20H23NO2 and a molecular weight of 309.41 g/mol. Its IUPAC name is (2S,4aS,8aR)-2-benzyl-4a,8,8-trimethyl-7-oxo-2,3,4,8a-tetrahydrochromene-6-carbonitrile.
| Compound Name | (2S,4aS,8aR)-2-benzyl-4a,8,8-trimethyl-7-oxo-2,3,4,8a-tetrahydrochromene-6-carbonitrile |
|---|---|
| PubChem CID | 135263670 |
| Molecular Formula | C20H23NO2 |
| Molecular Weight | 309.41 g/mol |
| Exact Mass | 309.17 |
| IUPAC Name | (2S,4aS,8aR)-2-benzyl-4a,8,8-trimethyl-7-oxo-2,3,4,8a-tetrahydrochromene-6-carbonitrile |
| SMILES | CC1(C)C(=O)C(C#N)=C[C@]2(C)CC[C@@H](Cc3ccccc3)O[C@@H]12 |
| InChI | InChI=1S/C20H23NO2/c1-19(2)17(22)15(13-21)12-20(3)10-9-16(23-18(19)20)11-14-7-5-4-6-8-14/h4-8,12,16,18H,9-11H2,1-3H3/t16-,18-,20-/m0/s1 |
| InChIKey | ZFOHMCSYBFGJKB-QRFRQXIXSA-N |
| XLogP | 3.84 |
| TPSA | 50.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.41 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |