C28H27N5O5 — CID 135263956
3-(2-benzoyl-5-nitro-3,4-dihydro-1H-isoquinolin-7-yl)-3-(1-ethyl-4-methylbenzotriazol-5-yl)propanoic acid (PubChem CID 135263956) has the molecular formula C28H27N5O5 and a molecular weight of 513.55 g/mol. Its IUPAC name is 3-(2-benzoyl-5-nitro-3,4-dihydro-1H-isoquinolin-7-yl)-3-(1-ethyl-4-methylbenzotriazol-5-yl)propanoic acid.
| Compound Name | 3-(2-benzoyl-5-nitro-3,4-dihydro-1H-isoquinolin-7-yl)-3-(1-ethyl-4-methylbenzotriazol-5-yl)propanoic acid |
|---|---|
| PubChem CID | 135263956 |
| Molecular Formula | C28H27N5O5 |
| Molecular Weight | 513.55 g/mol |
| Exact Mass | 513.20 |
| IUPAC Name | 3-(2-benzoyl-5-nitro-3,4-dihydro-1H-isoquinolin-7-yl)-3-(1-ethyl-4-methylbenzotriazol-5-yl)propanoic acid |
| SMILES | CCn1nnc2c(C)c(C(CC(=O)O)c3cc4c(c([N+](=O)[O-])c3)CCN(C(=O)c3ccccc3)C4)ccc21 |
| InChI | InChI=1S/C28H27N5O5/c1-3-32-24-10-9-21(17(2)27(24)29-30-32)23(15-26(34)35)19-13-20-16-31(28(36)18-7-5-4-6-8-18)12-11-22(20)25(14-19)33(37)38/h4-10,13-14,23H,3,11-12,15-16H2,1-2H3,(H,34,35) |
| InChIKey | BWQOZDCZTAROBM-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 131.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.55 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|