C38H33ClN4S — CID 135264968
3-[(3E,5Z)-4-[4-(3-chlorophenyl)-6-phenyl-1,3,5-triazin-2-yl]hepta-3,5-dien-2-yl]-10,10-dimethyl-[1]benzothiolo[2,3-e]indole (PubChem CID 135264968) has the molecular formula C38H33ClN4S and a molecular weight of 613.23 g/mol. Its IUPAC name is 3-[(3E,5Z)-4-[4-(3-chlorophenyl)-6-phenyl-1,3,5-triazin-2-yl]hepta-3,5-dien-2-yl]-10,10-dimethyl-[1]benzothiolo[2,3-e]indole.
| Compound Name | 3-[(3E,5Z)-4-[4-(3-chlorophenyl)-6-phenyl-1,3,5-triazin-2-yl]hepta-3,5-dien-2-yl]-10,10-dimethyl-[1]benzothiolo[2,3-e]indole |
|---|---|
| PubChem CID | 135264968 |
| Molecular Formula | C38H33ClN4S |
| Molecular Weight | 613.23 g/mol |
| Exact Mass | 612.21 |
| IUPAC Name | 3-[(3E,5Z)-4-[4-(3-chlorophenyl)-6-phenyl-1,3,5-triazin-2-yl]hepta-3,5-dien-2-yl]-10,10-dimethyl-[1]benzothiolo[2,3-e]indole |
| SMILES | C/C=C\C(=C/C(C)n1ccc2c3c(ccc21)-c1ccccc1S3(C)C)c1nc(-c2ccccc2)nc(-c2cccc(Cl)c2)n1 |
| InChI | InChI=1S/C38H33ClN4S/c1-5-12-27(37-40-36(26-13-7-6-8-14-26)41-38(42-37)28-15-11-16-29(39)24-28)23-25(2)43-22-21-32-33(43)20-19-31-30-17-9-10-18-34(30)44(3,4)35(31)32/h5-25H,1-4H3/b12-5-,27-23+ |
| InChIKey | WLPZQVQGEFBNRB-GLBQCTQOSA-N |
| XLogP | 10.50 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 613.23 |
| LogP ≤ 5 | 10.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|