C15H21N3O — CID 135265142
1-[(2E,4Z)-hepta-2,4-dien-6-yn-3-yl]-8-methyl-1,3,8-triazaspiro[4.5]decan-4-one (PubChem CID 135265142) has the molecular formula C15H21N3O and a molecular weight of 259.35 g/mol. Its IUPAC name is 1-[(2E,4Z)-hepta-2,4-dien-6-yn-3-yl]-8-methyl-1,3,8-triazaspiro[4.5]decan-4-one.
| Compound Name | 1-[(2E,4Z)-hepta-2,4-dien-6-yn-3-yl]-8-methyl-1,3,8-triazaspiro[4.5]decan-4-one |
|---|---|
| PubChem CID | 135265142 |
| Molecular Formula | C15H21N3O |
| Molecular Weight | 259.35 g/mol |
| Exact Mass | 259.17 |
| IUPAC Name | 1-[(2E,4Z)-hepta-2,4-dien-6-yn-3-yl]-8-methyl-1,3,8-triazaspiro[4.5]decan-4-one |
| SMILES | C#C/C=C\C(=C/C)N1CNC(=O)C12CCN(C)CC2 |
| InChI | InChI=1S/C15H21N3O/c1-4-6-7-13(5-2)18-12-16-14(19)15(18)8-10-17(3)11-9-15/h1,5-7H,8-12H2,2-3H3,(H,16,19)/b7-6-,13-5+ |
| InChIKey | HJIKBMWBJVGXLM-ZQNRWWJISA-N |
| XLogP | 0.93 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.35 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|