About [2-methoxy-5-[methyl-(2-oxochromen-4-yl)amino]phenyl] pent-4-enoate
[2-methoxy-5-[methyl-(2-oxochromen-4-yl)amino]phenyl] pent-4-enoate (PubChem CID 135265436) has the molecular formula C22H21NO5
and a molecular weight of 379.41 g/mol. Its IUPAC name is [2-methoxy-5-[methyl-(2-oxochromen-4-yl)amino]phenyl] pent-4-enoate.
Molecular Properties
| Compound Name | [2-methoxy-5-[methyl-(2-oxochromen-4-yl)amino]phenyl] pent-4-enoate |
| PubChem CID | 135265436 |
| Molecular Formula | C22H21NO5 |
| Molecular Weight | 379.41 g/mol |
| Exact Mass | 379.14 |
| IUPAC Name | [2-methoxy-5-[methyl-(2-oxochromen-4-yl)amino]phenyl] pent-4-enoate |
| SMILES | C=CCCC(=O)Oc1cc(N(C)c2cc(=O)oc3ccccc23)ccc1OC |
| InChI | InChI=1S/C22H21NO5/c1-4-5-10-21(24)28-20-13-15(11-12-19(20)26-3)23(2)17-14-22(25)27-18-9-7-6-8-16(17)18/h4,6-9,11-14H,1,5,10H2,2-3H3 |
| InChIKey | CWUYHJXBKUJXGB-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 68.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 379.41 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze [2-methoxy-5-[methyl-(2-oxochromen-4-yl)amino]phenyl] pent-4-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-methoxy-5-[methyl-(2-oxochromen-4-yl)amino]phenyl] pent-4-enoate?
The IUPAC name of [2-methoxy-5-[methyl-(2-oxochromen-4-yl)amino]phenyl] pent-4-enoate (CID 135265436) is [2-methoxy-5-[methyl-(2-oxochromen-4-yl)amino]phenyl] pent-4-enoate.
What is the SMILES notation for [2-methoxy-5-[methyl-(2-oxochromen-4-yl)amino]phenyl] pent-4-enoate?
The canonical SMILES for [2-methoxy-5-[methyl-(2-oxochromen-4-yl)amino]phenyl] pent-4-enoate is C=CCCC(=O)Oc1cc(N(C)c2cc(=O)oc3ccccc23)ccc1OC.
What is the InChIKey of [2-methoxy-5-[methyl-(2-oxochromen-4-yl)amino]phenyl] pent-4-enoate?
The InChIKey is CWUYHJXBKUJXGB-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H21NO5/c1-4-5-10-21(24)28-20-13-15(11-12-19(20)26-3)23(2)17-14-22(25)27-18-9-7-6-8-16(17)18/h4,6-9,11-14H,1,5,10H2,2-3H3.
What are the key properties of [2-methoxy-5-[methyl-(2-oxochromen-4-yl)amino]phenyl] pent-4-enoate?
[2-methoxy-5-[methyl-(2-oxochromen-4-yl)amino]phenyl] pent-4-enoate has a molecular weight of 379.41 g/mol, XLogP of 4.44, 7 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [2-methoxy-5-[methyl-(2-oxochromen-4-yl)amino]phenyl] pent-4-enoate is sourced from PubChem (CID 135265436), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).