C20H23NO3 — CID 135265456
4-(6-methoxy-3,4-dihydro-2H-quinolin-1-yl)-4-methyl-5,6-dihydro-3H-chromen-2-one (PubChem CID 135265456) has the molecular formula C20H23NO3 and a molecular weight of 325.41 g/mol. Its IUPAC name is 4-(6-methoxy-3,4-dihydro-2H-quinolin-1-yl)-4-methyl-5,6-dihydro-3H-chromen-2-one.
| Compound Name | 4-(6-methoxy-3,4-dihydro-2H-quinolin-1-yl)-4-methyl-5,6-dihydro-3H-chromen-2-one |
|---|---|
| PubChem CID | 135265456 |
| Molecular Formula | C20H23NO3 |
| Molecular Weight | 325.41 g/mol |
| Exact Mass | 325.17 |
| IUPAC Name | 4-(6-methoxy-3,4-dihydro-2H-quinolin-1-yl)-4-methyl-5,6-dihydro-3H-chromen-2-one |
| SMILES | COc1ccc2c(c1)CCCN2C1(C)CC(=O)OC2=C1CCC=C2 |
| InChI | InChI=1S/C20H23NO3/c1-20(13-19(22)24-18-8-4-3-7-16(18)20)21-11-5-6-14-12-15(23-2)9-10-17(14)21/h4,8-10,12H,3,5-7,11,13H2,1-2H3 |
| InChIKey | NTCVDTMLGUCGAI-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.41 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|