C23H35NO — CID 135265755
[4-[[1-(5-ethyl-6-methylhepta-1,6-dien-2-yl)piperidin-4-yl]methyl]phenyl]methanol (PubChem CID 135265755) has the molecular formula C23H35NO and a molecular weight of 341.54 g/mol. Its IUPAC name is [4-[[1-(5-ethyl-6-methylhepta-1,6-dien-2-yl)piperidin-4-yl]methyl]phenyl]methanol.
| Compound Name | [4-[[1-(5-ethyl-6-methylhepta-1,6-dien-2-yl)piperidin-4-yl]methyl]phenyl]methanol |
|---|---|
| PubChem CID | 135265755 |
| Molecular Formula | C23H35NO |
| Molecular Weight | 341.54 g/mol |
| Exact Mass | 341.27 |
| IUPAC Name | [4-[[1-(5-ethyl-6-methylhepta-1,6-dien-2-yl)piperidin-4-yl]methyl]phenyl]methanol |
| SMILES | C=C(C)C(CC)CCC(=C)N1CCC(Cc2ccc(CO)cc2)CC1 |
| InChI | InChI=1S/C23H35NO/c1-5-23(18(2)3)11-6-19(4)24-14-12-21(13-15-24)16-20-7-9-22(17-25)10-8-20/h7-10,21,23,25H,2,4-6,11-17H2,1,3H3 |
| InChIKey | KAZZOPBFQIGVIQ-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.54 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|