C25H29F5N6O5 — CID 135265772
methyl 2,2-dimethyl-3-[[4-methyl-5-[2-[5-(2,2,3,3,3-pentafluoropropoxy)-1-(propoxymethyl)-1,2,4-triazol-3-yl]pyrimidin-5-yl]-2-pyridinyl]oxy]propanoate (PubChem CID 135265772) has the molecular formula C25H29F5N6O5 and a molecular weight of 588.53 g/mol. Its IUPAC name is methyl 2,2-dimethyl-3-[[4-methyl-5-[2-[5-(2,2,3,3,3-pentafluoropropoxy)-1-(propoxymethyl)-1,2,4-triazol-3-yl]pyrimidin-5-yl]-2-pyridinyl]oxy]propanoate.
| Compound Name | methyl 2,2-dimethyl-3-[[4-methyl-5-[2-[5-(2,2,3,3,3-pentafluoropropoxy)-1-(propoxymethyl)-1,2,4-triazol-3-yl]pyrimidin-5-yl]-2-pyridinyl]oxy]propanoate |
|---|---|
| PubChem CID | 135265772 |
| Molecular Formula | C25H29F5N6O5 |
| Molecular Weight | 588.53 g/mol |
| Exact Mass | 588.21 |
| IUPAC Name | methyl 2,2-dimethyl-3-[[4-methyl-5-[2-[5-(2,2,3,3,3-pentafluoropropoxy)-1-(propoxymethyl)-1,2,4-triazol-3-yl]pyrimidin-5-yl]-2-pyridinyl]oxy]propanoate |
| SMILES | CCCOCn1nc(-c2ncc(-c3cnc(OCC(C)(C)C(=O)OC)cc3C)cn2)nc1OCC(F)(F)C(F)(F)F |
| InChI | InChI=1S/C25H29F5N6O5/c1-6-7-39-14-36-22(41-13-24(26,27)25(28,29)30)34-20(35-36)19-32-9-16(10-33-19)17-11-31-18(8-15(17)2)40-12-23(3,4)21(37)38-5/h8-11H,6-7,12-14H2,1-5H3 |
| InChIKey | GKLYGGAUYQFYTP-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 123.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.53 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|