About (1R)-3-(4-sulfanylidenepentoxy)spiro[8-oxabicyclo[3.2.1]octane-6,3'-oxolane]-2'-one
(1R)-3-(4-sulfanylidenepentoxy)spiro[8-oxabicyclo[3.2.1]octane-6,3'-oxolane]-2'-one (PubChem CID 135266005) has the molecular formula C15H22O4S
and a molecular weight of 298.40 g/mol. Its IUPAC name is (1R)-3-(4-sulfanylidenepentoxy)spiro[8-oxabicyclo[3.2.1]octane-6,3'-oxolane]-2'-one.
Molecular Properties
| Compound Name | (1R)-3-(4-sulfanylidenepentoxy)spiro[8-oxabicyclo[3.2.1]octane-6,3'-oxolane]-2'-one |
| PubChem CID | 135266005 |
| Molecular Formula | C15H22O4S |
| Molecular Weight | 298.40 g/mol |
| Exact Mass | 298.12 |
| IUPAC Name | (1R)-3-(4-sulfanylidenepentoxy)spiro[8-oxabicyclo[3.2.1]octane-6,3'-oxolane]-2'-one |
| SMILES | CC(=S)CCCOC1CC2O[C@@H](C1)CC21CCOC1=O |
| InChI | InChI=1S/C15H22O4S/c1-10(20)3-2-5-17-11-7-12-9-15(13(8-11)19-12)4-6-18-14(15)16/h11-13H,2-9H2,1H3/t11?,12-,13?,15?/m0/s1 |
| InChIKey | SIPDALOXYUNBEC-WEJPXRPDSA-N |
| XLogP | 2.43 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 298.40 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze (1R)-3-(4-sulfanylidenepentoxy)spiro[8-oxabicyclo[3.2.1]octane-6,3'-oxolane]-2'-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1R)-3-(4-sulfanylidenepentoxy)spiro[8-oxabicyclo[3.2.1]octane-6,3'-oxolane]-2'-one?
The IUPAC name of (1R)-3-(4-sulfanylidenepentoxy)spiro[8-oxabicyclo[3.2.1]octane-6,3'-oxolane]-2'-one (CID 135266005) is (1R)-3-(4-sulfanylidenepentoxy)spiro[8-oxabicyclo[3.2.1]octane-6,3'-oxolane]-2'-one.
What is the SMILES notation for (1R)-3-(4-sulfanylidenepentoxy)spiro[8-oxabicyclo[3.2.1]octane-6,3'-oxolane]-2'-one?
The canonical SMILES for (1R)-3-(4-sulfanylidenepentoxy)spiro[8-oxabicyclo[3.2.1]octane-6,3'-oxolane]-2'-one is CC(=S)CCCOC1CC2O[C@@H](C1)CC21CCOC1=O.
What is the InChIKey of (1R)-3-(4-sulfanylidenepentoxy)spiro[8-oxabicyclo[3.2.1]octane-6,3'-oxolane]-2'-one?
The InChIKey is SIPDALOXYUNBEC-WEJPXRPDSA-N. The full InChI is InChI=1S/C15H22O4S/c1-10(20)3-2-5-17-11-7-12-9-15(13(8-11)19-12)4-6-18-14(15)16/h11-13H,2-9H2,1H3/t11?,12-,13?,15?/m0/s1.
What are the key properties of (1R)-3-(4-sulfanylidenepentoxy)spiro[8-oxabicyclo[3.2.1]octane-6,3'-oxolane]-2'-one?
(1R)-3-(4-sulfanylidenepentoxy)spiro[8-oxabicyclo[3.2.1]octane-6,3'-oxolane]-2'-one has a molecular weight of 298.40 g/mol, XLogP of 2.43, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (1R)-3-(4-sulfanylidenepentoxy)spiro[8-oxabicyclo[3.2.1]octane-6,3'-oxolane]-2'-one is sourced from PubChem (CID 135266005), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).