C50H86N2O6 — CID 135266051
(2,2,6,6-tetramethylpiperidin-4-yl) 5-[3-[5-oxo-5-(2,2,6,6-tetramethylheptan-4-yloxy)pentyl]-4-[5-oxo-5-(2,2,6,6-tetramethylpiperidin-4-yl)oxypentyl]phenyl]pentanoate (PubChem CID 135266051) has the molecular formula C50H86N2O6 and a molecular weight of 811.25 g/mol. Its IUPAC name is (2,2,6,6-tetramethylpiperidin-4-yl) 5-[3-[5-oxo-5-(2,2,6,6-tetramethylheptan-4-yloxy)pentyl]-4-[5-oxo-5-(2,2,6,6-tetramethylpiperidin-4-yl)oxypentyl]phenyl]pentanoate.
| Compound Name | (2,2,6,6-tetramethylpiperidin-4-yl) 5-[3-[5-oxo-5-(2,2,6,6-tetramethylheptan-4-yloxy)pentyl]-4-[5-oxo-5-(2,2,6,6-tetramethylpiperidin-4-yl)oxypentyl]phenyl]pentanoate |
|---|---|
| PubChem CID | 135266051 |
| Molecular Formula | C50H86N2O6 |
| Molecular Weight | 811.25 g/mol |
| Exact Mass | 810.65 |
| IUPAC Name | (2,2,6,6-tetramethylpiperidin-4-yl) 5-[3-[5-oxo-5-(2,2,6,6-tetramethylheptan-4-yloxy)pentyl]-4-[5-oxo-5-(2,2,6,6-tetramethylpiperidin-4-yl)oxypentyl]phenyl]pentanoate |
| SMILES | CC(C)(C)CC(CC(C)(C)C)OC(=O)CCCCc1cc(CCCCC(=O)OC2CC(C)(C)NC(C)(C)C2)ccc1CCCCC(=O)OC1CC(C)(C)NC(C)(C)C1 |
| InChI | InChI=1S/C50H86N2O6/c1-45(2,3)30-39(31-46(4,5)6)56-42(53)26-20-17-23-38-29-36(21-15-18-24-43(54)57-40-32-47(7,8)51-48(9,10)33-40)27-28-37(38)22-16-19-25-44(55)58-41-34-49(11,12)52-50(13,14)35-41/h27-29,39-41,51-52H,15-26,30-35H2,1-14H3 |
| InChIKey | UUFPORCEZAILEF-UHFFFAOYSA-N |
| XLogP | 11.31 |
| TPSA | 102.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 811.25 |
| LogP ≤ 5 | 11.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|