C26H36FN — CID 135266313
(2Z,5E,6Z)-3-ethenyl-N-[(2E)-2-ethenyl-5-methylhexa-2,4-dienyl]-N-ethyl-5-(2-fluoroethylidene)-7-methyl-4-methylidenenona-2,6,8-trien-2-amine (PubChem CID 135266313) has the molecular formula C26H36FN and a molecular weight of 381.58 g/mol. Its IUPAC name is (2Z,5E,6Z)-3-ethenyl-N-[(2E)-2-ethenyl-5-methylhexa-2,4-dienyl]-N-ethyl-5-(2-fluoroethylidene)-7-methyl-4-methylidenenona-2,6,8-trien-2-amine.
| Compound Name | (2Z,5E,6Z)-3-ethenyl-N-[(2E)-2-ethenyl-5-methylhexa-2,4-dienyl]-N-ethyl-5-(2-fluoroethylidene)-7-methyl-4-methylidenenona-2,6,8-trien-2-amine |
|---|---|
| PubChem CID | 135266313 |
| Molecular Formula | C26H36FN |
| Molecular Weight | 381.58 g/mol |
| Exact Mass | 381.28 |
| IUPAC Name | (2Z,5E,6Z)-3-ethenyl-N-[(2E)-2-ethenyl-5-methylhexa-2,4-dienyl]-N-ethyl-5-(2-fluoroethylidene)-7-methyl-4-methylidenenona-2,6,8-trien-2-amine |
| SMILES | C=C/C(C)=C\C(=C/CF)C(=C)/C(C=C)=C(/C)N(CC)C/C(C=C)=C/C=C(C)C |
| InChI | InChI=1S/C26H36FN/c1-10-21(7)18-25(16-17-27)22(8)26(12-3)23(9)28(13-4)19-24(11-2)15-14-20(5)6/h10-12,14-16,18H,1-3,8,13,17,19H2,4-7,9H3/b21-18-,24-15+,25-16+,26-23- |
| InChIKey | JLZGEZBWAPJJAM-JTEIFDLBSA-N |
| XLogP | 7.43 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.58 |
| LogP ≤ 5 | 7.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|