C41H41FN6O2S2 — CID 135266478
4-[[4-[4-[3-[2-(4-fluorophenyl)-1,4,5-trimethylpyrrol-3-yl]phenyl]piperazin-1-yl]cyclohexa-1,3-dien-1-yl]amino]sulfanyl-2-nitro-N-phenylsulfanylaniline (PubChem CID 135266478) has the molecular formula C41H41FN6O2S2 and a molecular weight of 732.95 g/mol. Its IUPAC name is 4-[[4-[4-[3-[2-(4-fluorophenyl)-1,4,5-trimethylpyrrol-3-yl]phenyl]piperazin-1-yl]cyclohexa-1,3-dien-1-yl]amino]sulfanyl-2-nitro-N-phenylsulfanylaniline.
| Compound Name | 4-[[4-[4-[3-[2-(4-fluorophenyl)-1,4,5-trimethylpyrrol-3-yl]phenyl]piperazin-1-yl]cyclohexa-1,3-dien-1-yl]amino]sulfanyl-2-nitro-N-phenylsulfanylaniline |
|---|---|
| PubChem CID | 135266478 |
| Molecular Formula | C41H41FN6O2S2 |
| Molecular Weight | 732.95 g/mol |
| Exact Mass | 732.27 |
| IUPAC Name | 4-[[4-[4-[3-[2-(4-fluorophenyl)-1,4,5-trimethylpyrrol-3-yl]phenyl]piperazin-1-yl]cyclohexa-1,3-dien-1-yl]amino]sulfanyl-2-nitro-N-phenylsulfanylaniline |
| SMILES | Cc1c(-c2cccc(N3CCN(C4=CC=C(NSc5ccc(NSc6ccccc6)c([N+](=O)[O-])c5)CC4)CC3)c2)c(-c2ccc(F)cc2)n(C)c1C |
| InChI | InChI=1S/C41H41FN6O2S2/c1-28-29(2)45(3)41(30-12-14-32(42)15-13-30)40(28)31-8-7-9-35(26-31)47-24-22-46(23-25-47)34-18-16-33(17-19-34)43-52-37-20-21-38(39(27-37)48(49)50)44-51-36-10-5-4-6-11-36/h4-16,18,20-21,26-27,43-44H,17,19,22-25H2,1-3H3 |
| InChIKey | QGCMFCDJFNCYEL-UHFFFAOYSA-N |
| XLogP | 10.12 |
| TPSA | 78.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 732.95 |
| LogP ≤ 5 | 10.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|