C41H37ClF3N5O2S3 — CID 135266524
4-[4-[4-[3-[2-(4-chlorophenyl)-1,5-dimethylpyrrol-3-yl]phenyl]piperazin-1-yl]anilino]sulfanyl-N-phenylsulfanyl-2-(trifluoromethylsulfonyl)aniline (PubChem CID 135266524) has the molecular formula C41H37ClF3N5O2S3 and a molecular weight of 820.43 g/mol. Its IUPAC name is 4-[4-[4-[3-[2-(4-chlorophenyl)-1,5-dimethylpyrrol-3-yl]phenyl]piperazin-1-yl]anilino]sulfanyl-N-phenylsulfanyl-2-(trifluoromethylsulfonyl)aniline.
| Compound Name | 4-[4-[4-[3-[2-(4-chlorophenyl)-1,5-dimethylpyrrol-3-yl]phenyl]piperazin-1-yl]anilino]sulfanyl-N-phenylsulfanyl-2-(trifluoromethylsulfonyl)aniline |
|---|---|
| PubChem CID | 135266524 |
| Molecular Formula | C41H37ClF3N5O2S3 |
| Molecular Weight | 820.43 g/mol |
| Exact Mass | 819.18 |
| IUPAC Name | 4-[4-[4-[3-[2-(4-chlorophenyl)-1,5-dimethylpyrrol-3-yl]phenyl]piperazin-1-yl]anilino]sulfanyl-N-phenylsulfanyl-2-(trifluoromethylsulfonyl)aniline |
| SMILES | Cc1cc(-c2cccc(N3CCN(c4ccc(NSc5ccc(NSc6ccccc6)c(S(=O)(=O)C(F)(F)F)c5)cc4)CC3)c2)c(-c2ccc(Cl)cc2)n1C |
| InChI | InChI=1S/C41H37ClF3N5O2S3/c1-28-25-37(40(48(28)2)29-11-13-31(42)14-12-29)30-7-6-8-34(26-30)50-23-21-49(22-24-50)33-17-15-32(16-18-33)46-54-36-19-20-38(47-53-35-9-4-3-5-10-35)39(27-36)55(51,52)41(43,44)45/h3-20,25-27,46-47H,21-24H2,1-2H3 |
| InChIKey | SXCOQSWTBKDHBH-UHFFFAOYSA-N |
| XLogP | 11.18 |
| TPSA | 69.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 820.43 |
| LogP ≤ 5 | 11.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|