C24H16N6O — CID 135267115
5-[10-(3-aminophenyl)-9-oxopyrido[3,2-h][1,5]naphthyridin-2-yl]-3-methylpyridine-2-carbonitrile (PubChem CID 135267115) has the molecular formula C24H16N6O and a molecular weight of 404.43 g/mol. Its IUPAC name is 5-[10-(3-aminophenyl)-9-oxopyrido[3,2-h][1,5]naphthyridin-2-yl]-3-methylpyridine-2-carbonitrile.
| Compound Name | 5-[10-(3-aminophenyl)-9-oxopyrido[3,2-h][1,5]naphthyridin-2-yl]-3-methylpyridine-2-carbonitrile |
|---|---|
| PubChem CID | 135267115 |
| Molecular Formula | C24H16N6O |
| Molecular Weight | 404.43 g/mol |
| Exact Mass | 404.14 |
| IUPAC Name | 5-[10-(3-aminophenyl)-9-oxopyrido[3,2-h][1,5]naphthyridin-2-yl]-3-methylpyridine-2-carbonitrile |
| SMILES | Cc1cc(-c2ccc3ncc4ccc(=O)n(-c5cccc(N)c5)c4c3n2)cnc1C#N |
| InChI | InChI=1S/C24H16N6O/c1-14-9-16(13-28-21(14)11-25)19-6-7-20-23(29-19)24-15(12-27-20)5-8-22(31)30(24)18-4-2-3-17(26)10-18/h2-10,12-13H,26H2,1H3 |
| InChIKey | SUYNCYWBNSUAKO-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 110.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.43 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|