About 3,5-bis(difluoromethyl)-2-methyl-1,3-dihydropyrazole
3,5-bis(difluoromethyl)-2-methyl-1,3-dihydropyrazole (PubChem CID 135267363) has the molecular formula C6H8F4N2
and a molecular weight of 184.14 g/mol. Its IUPAC name is 3,5-bis(difluoromethyl)-2-methyl-1,3-dihydropyrazole.
Molecular Properties
| Compound Name | 3,5-bis(difluoromethyl)-2-methyl-1,3-dihydropyrazole |
| PubChem CID | 135267363 |
| Molecular Formula | C6H8F4N2 |
| Molecular Weight | 184.14 g/mol |
| Exact Mass | 184.06 |
| IUPAC Name | 3,5-bis(difluoromethyl)-2-methyl-1,3-dihydropyrazole |
| SMILES | CN1NC(C(F)F)=CC1C(F)F |
| InChI | InChI=1S/C6H8F4N2/c1-12-4(6(9)10)2-3(11-12)5(7)8/h2,4-6,11H,1H3 |
| InChIKey | SLRGODHQDOHRKU-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.14 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3,5-bis(difluoromethyl)-2-methyl-1,3-dihydropyrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,5-bis(difluoromethyl)-2-methyl-1,3-dihydropyrazole?
The IUPAC name of 3,5-bis(difluoromethyl)-2-methyl-1,3-dihydropyrazole (CID 135267363) is 3,5-bis(difluoromethyl)-2-methyl-1,3-dihydropyrazole.
What is the SMILES notation for 3,5-bis(difluoromethyl)-2-methyl-1,3-dihydropyrazole?
The canonical SMILES for 3,5-bis(difluoromethyl)-2-methyl-1,3-dihydropyrazole is CN1NC(C(F)F)=CC1C(F)F.
What is the InChIKey of 3,5-bis(difluoromethyl)-2-methyl-1,3-dihydropyrazole?
The InChIKey is SLRGODHQDOHRKU-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8F4N2/c1-12-4(6(9)10)2-3(11-12)5(7)8/h2,4-6,11H,1H3.
What are the key properties of 3,5-bis(difluoromethyl)-2-methyl-1,3-dihydropyrazole?
3,5-bis(difluoromethyl)-2-methyl-1,3-dihydropyrazole has a molecular weight of 184.14 g/mol, XLogP of 1.22, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3,5-bis(difluoromethyl)-2-methyl-1,3-dihydropyrazole is sourced from PubChem (CID 135267363), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).