C26H31F5N4O2 — CID 135267369
3-[(1R,3R)-1-[3,5-difluoro-2-[2-(3-fluoropropylamino)ethoxy]-4-pyridinyl]-3,6-dimethyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-2,2-difluoropropan-1-ol (PubChem CID 135267369) has the molecular formula C26H31F5N4O2 and a molecular weight of 526.55 g/mol. Its IUPAC name is 3-[(1R,3R)-1-[3,5-difluoro-2-[2-(3-fluoropropylamino)ethoxy]-4-pyridinyl]-3,6-dimethyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-2,2-difluoropropan-1-ol.
| Compound Name | 3-[(1R,3R)-1-[3,5-difluoro-2-[2-(3-fluoropropylamino)ethoxy]-4-pyridinyl]-3,6-dimethyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-2,2-difluoropropan-1-ol |
|---|---|
| PubChem CID | 135267369 |
| Molecular Formula | C26H31F5N4O2 |
| Molecular Weight | 526.55 g/mol |
| Exact Mass | 526.24 |
| IUPAC Name | 3-[(1R,3R)-1-[3,5-difluoro-2-[2-(3-fluoropropylamino)ethoxy]-4-pyridinyl]-3,6-dimethyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-2,2-difluoropropan-1-ol |
| SMILES | Cc1ccc2[nH]c3c(c2c1)C[C@@H](C)N(CC(F)(F)CO)[C@@H]3c1c(F)cnc(OCCNCCCF)c1F |
| InChI | InChI=1S/C26H31F5N4O2/c1-15-4-5-20-17(10-15)18-11-16(2)35(13-26(30,31)14-36)24(23(18)34-20)21-19(28)12-33-25(22(21)29)37-9-8-32-7-3-6-27/h4-5,10,12,16,24,32,34,36H,3,6-9,11,13-14H2,1-2H3/t16-,24-/m1/s1 |
| InChIKey | OTBYGSVELWVBBB-VOIUYBSRSA-N |
| XLogP | 4.44 |
| TPSA | 73.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.55 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|