C24H30F3N3O3 — CID 135268001
1-propyl-5-[2-[2-[2-(2,2,2-trifluoroethoxy)phenoxy]ethylamino]ethyl]-2,3-dihydroindole-7-carboxamide (PubChem CID 135268001) has the molecular formula C24H30F3N3O3 and a molecular weight of 465.52 g/mol. Its IUPAC name is 1-propyl-5-[2-[2-[2-(2,2,2-trifluoroethoxy)phenoxy]ethylamino]ethyl]-2,3-dihydroindole-7-carboxamide.
| Compound Name | 1-propyl-5-[2-[2-[2-(2,2,2-trifluoroethoxy)phenoxy]ethylamino]ethyl]-2,3-dihydroindole-7-carboxamide |
|---|---|
| PubChem CID | 135268001 |
| Molecular Formula | C24H30F3N3O3 |
| Molecular Weight | 465.52 g/mol |
| Exact Mass | 465.22 |
| IUPAC Name | 1-propyl-5-[2-[2-[2-(2,2,2-trifluoroethoxy)phenoxy]ethylamino]ethyl]-2,3-dihydroindole-7-carboxamide |
| SMILES | CCCN1CCc2cc(CCNCCOc3ccccc3OCC(F)(F)F)cc(C(N)=O)c21 |
| InChI | InChI=1S/C24H30F3N3O3/c1-2-11-30-12-8-18-14-17(15-19(22(18)30)23(28)31)7-9-29-10-13-32-20-5-3-4-6-21(20)33-16-24(25,26)27/h3-6,14-15,29H,2,7-13,16H2,1H3,(H2,28,31) |
| InChIKey | PHQQRTYGYPFZCU-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 76.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.52 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|