C24H24N6O — CID 135268489
N-[6-[2-[(4-benzylphthalazin-1-yl)amino]ethylamino]-3-pyridinyl]acetamide (PubChem CID 135268489) has the molecular formula C24H24N6O and a molecular weight of 412.50 g/mol. Its IUPAC name is N-[6-[2-[(4-benzylphthalazin-1-yl)amino]ethylamino]-3-pyridinyl]acetamide.
| Compound Name | N-[6-[2-[(4-benzylphthalazin-1-yl)amino]ethylamino]-3-pyridinyl]acetamide |
|---|---|
| PubChem CID | 135268489 |
| Molecular Formula | C24H24N6O |
| Molecular Weight | 412.50 g/mol |
| Exact Mass | 412.20 |
| IUPAC Name | N-[6-[2-[(4-benzylphthalazin-1-yl)amino]ethylamino]-3-pyridinyl]acetamide |
| SMILES | CC(=O)Nc1ccc(NCCNc2nnc(Cc3ccccc3)c3ccccc23)nc1 |
| InChI | InChI=1S/C24H24N6O/c1-17(31)28-19-11-12-23(27-16-19)25-13-14-26-24-21-10-6-5-9-20(21)22(29-30-24)15-18-7-3-2-4-8-18/h2-12,16H,13-15H2,1H3,(H,25,27)(H,26,30)(H,28,31) |
| InChIKey | ZMCOTYZODIISFP-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 91.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.50 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|