About 1-N-[(Z)-5-methyl-4-[(Z)-prop-1-enyl]oct-4-en-2-yl]-1-N'-prop-1-en-2-ylethene-1,1-diamine
1-N-[(Z)-5-methyl-4-[(Z)-prop-1-enyl]oct-4-en-2-yl]-1-N'-prop-1-en-2-ylethene-1,1-diamine (PubChem CID 135269084) has the molecular formula C17H30N2
and a molecular weight of 262.44 g/mol. Its IUPAC name is 1-N-[(Z)-5-methyl-4-[(Z)-prop-1-enyl]oct-4-en-2-yl]-1-N'-prop-1-en-2-ylethene-1,1-diamine.
Molecular Properties
| Compound Name | 1-N-[(Z)-5-methyl-4-[(Z)-prop-1-enyl]oct-4-en-2-yl]-1-N'-prop-1-en-2-ylethene-1,1-diamine |
| PubChem CID | 135269084 |
| Molecular Formula | C17H30N2 |
| Molecular Weight | 262.44 g/mol |
| Exact Mass | 262.24 |
| IUPAC Name | 1-N-[(Z)-5-methyl-4-[(Z)-prop-1-enyl]oct-4-en-2-yl]-1-N'-prop-1-en-2-ylethene-1,1-diamine |
| SMILES | C=C(C)NC(=C)NC(C)CC(/C=C\C)=C(\C)CCC |
| InChI | InChI=1S/C17H30N2/c1-8-10-14(5)17(11-9-2)12-15(6)19-16(7)18-13(3)4/h9,11,15,18-19H,3,7-8,10,12H2,1-2,4-6H3/b11-9-,17-14+ |
| InChIKey | GTDMPMWYAJPCAU-QWAPPMFBSA-N |
| XLogP | 4.64 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.44 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 1-N-[(Z)-5-methyl-4-[(Z)-prop-1-enyl]oct-4-en-2-yl]-1-N'-prop-1-en-2-ylethene-1,1-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-N-[(Z)-5-methyl-4-[(Z)-prop-1-enyl]oct-4-en-2-yl]-1-N'-prop-1-en-2-ylethene-1,1-diamine?
The IUPAC name of 1-N-[(Z)-5-methyl-4-[(Z)-prop-1-enyl]oct-4-en-2-yl]-1-N'-prop-1-en-2-ylethene-1,1-diamine (CID 135269084) is 1-N-[(Z)-5-methyl-4-[(Z)-prop-1-enyl]oct-4-en-2-yl]-1-N'-prop-1-en-2-ylethene-1,1-diamine.
What is the SMILES notation for 1-N-[(Z)-5-methyl-4-[(Z)-prop-1-enyl]oct-4-en-2-yl]-1-N'-prop-1-en-2-ylethene-1,1-diamine?
The canonical SMILES for 1-N-[(Z)-5-methyl-4-[(Z)-prop-1-enyl]oct-4-en-2-yl]-1-N'-prop-1-en-2-ylethene-1,1-diamine is C=C(C)NC(=C)NC(C)CC(/C=C\C)=C(\C)CCC.
What is the InChIKey of 1-N-[(Z)-5-methyl-4-[(Z)-prop-1-enyl]oct-4-en-2-yl]-1-N'-prop-1-en-2-ylethene-1,1-diamine?
The InChIKey is GTDMPMWYAJPCAU-QWAPPMFBSA-N. The full InChI is InChI=1S/C17H30N2/c1-8-10-14(5)17(11-9-2)12-15(6)19-16(7)18-13(3)4/h9,11,15,18-19H,3,7-8,10,12H2,1-2,4-6H3/b11-9-,17-14+.
What are the key properties of 1-N-[(Z)-5-methyl-4-[(Z)-prop-1-enyl]oct-4-en-2-yl]-1-N'-prop-1-en-2-ylethene-1,1-diamine?
1-N-[(Z)-5-methyl-4-[(Z)-prop-1-enyl]oct-4-en-2-yl]-1-N'-prop-1-en-2-ylethene-1,1-diamine has a molecular weight of 262.44 g/mol, XLogP of 4.64, 9 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-N-[(Z)-5-methyl-4-[(Z)-prop-1-enyl]oct-4-en-2-yl]-1-N'-prop-1-en-2-ylethene-1,1-diamine is sourced from PubChem (CID 135269084), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).