C18H24FN — CID 135269196
(2E,4Z)-N-[(3Z,5E)-5-fluoroocta-3,5,7-trienyl]-4-propan-2-ylhepta-2,4-dien-6-yn-3-amine (PubChem CID 135269196) has the molecular formula C18H24FN and a molecular weight of 273.40 g/mol. Its IUPAC name is (2E,4Z)-N-[(3Z,5E)-5-fluoroocta-3,5,7-trienyl]-4-propan-2-ylhepta-2,4-dien-6-yn-3-amine.
| Compound Name | (2E,4Z)-N-[(3Z,5E)-5-fluoroocta-3,5,7-trienyl]-4-propan-2-ylhepta-2,4-dien-6-yn-3-amine |
|---|---|
| PubChem CID | 135269196 |
| Molecular Formula | C18H24FN |
| Molecular Weight | 273.40 g/mol |
| Exact Mass | 273.19 |
| IUPAC Name | (2E,4Z)-N-[(3Z,5E)-5-fluoroocta-3,5,7-trienyl]-4-propan-2-ylhepta-2,4-dien-6-yn-3-amine |
| SMILES | C#C/C=C(C(=C/C)\NCC/C=C\C(F)=C/C=C)/C(C)C |
| InChI | InChI=1S/C18H24FN/c1-6-11-16(19)13-9-10-14-20-18(8-3)17(12-7-2)15(4)5/h2,6,8-9,11-13,15,20H,1,10,14H2,3-5H3/b13-9-,16-11+,17-12-,18-8+ |
| InChIKey | AMHNWMUJZAIXFE-ASVPJUIOSA-N |
| XLogP | 4.68 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.40 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|