C18H27N3 — CID 135269209
(3Z,5Z)-N'-[(3Z,5Z)-5-(aminomethylidene)hepta-3,6-dienyl]-6-ethylocta-3,5,7-trienimidamide (PubChem CID 135269209) has the molecular formula C18H27N3 and a molecular weight of 285.44 g/mol. Its IUPAC name is (3Z,5Z)-N'-[(3Z,5Z)-5-(aminomethylidene)hepta-3,6-dienyl]-6-ethylocta-3,5,7-trienimidamide.
| Compound Name | (3Z,5Z)-N'-[(3Z,5Z)-5-(aminomethylidene)hepta-3,6-dienyl]-6-ethylocta-3,5,7-trienimidamide |
|---|---|
| PubChem CID | 135269209 |
| Molecular Formula | C18H27N3 |
| Molecular Weight | 285.44 g/mol |
| Exact Mass | 285.22 |
| IUPAC Name | (3Z,5Z)-N'-[(3Z,5Z)-5-(aminomethylidene)hepta-3,6-dienyl]-6-ethylocta-3,5,7-trienimidamide |
| SMILES | C=CC(/C=C\CC/N=C(\N)C/C=C\C=C(/C=C)CC)=C/N |
| InChI | InChI=1S/C18H27N3/c1-4-16(5-2)11-7-8-13-18(20)21-14-10-9-12-17(6-3)15-19/h4,6-9,11-12,15H,1,3,5,10,13-14,19H2,2H3,(H2,20,21)/b8-7-,12-9-,16-11+,17-15- |
| InChIKey | XHHSKMKTZYICFU-INYUAGKJSA-N |
| XLogP | 3.79 |
| TPSA | 64.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.44 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|