C24H26ClN5O4 — CID 135269262
9-[(4-chlorophenyl)methyl]-6-(3-hydroxypropyl)-2-methyl-10-[(6-methyl-3-pyridinyl)methoxy]-4-oxa-2,6,9,11-tetrazatricyclo[6.3.0.03,5]undeca-1(8),10-dien-7-one (PubChem CID 135269262) has the molecular formula C24H26ClN5O4 and a molecular weight of 483.96 g/mol. Its IUPAC name is 9-[(4-chlorophenyl)methyl]-6-(3-hydroxypropyl)-2-methyl-10-[(6-methyl-3-pyridinyl)methoxy]-4-oxa-2,6,9,11-tetrazatricyclo[6.3.0.03,5]undeca-1(8),10-dien-7-one.
| Compound Name | 9-[(4-chlorophenyl)methyl]-6-(3-hydroxypropyl)-2-methyl-10-[(6-methyl-3-pyridinyl)methoxy]-4-oxa-2,6,9,11-tetrazatricyclo[6.3.0.03,5]undeca-1(8),10-dien-7-one |
|---|---|
| PubChem CID | 135269262 |
| Molecular Formula | C24H26ClN5O4 |
| Molecular Weight | 483.96 g/mol |
| Exact Mass | 483.17 |
| IUPAC Name | 9-[(4-chlorophenyl)methyl]-6-(3-hydroxypropyl)-2-methyl-10-[(6-methyl-3-pyridinyl)methoxy]-4-oxa-2,6,9,11-tetrazatricyclo[6.3.0.03,5]undeca-1(8),10-dien-7-one |
| SMILES | Cc1ccc(COc2nc3c(n2Cc2ccc(Cl)cc2)C(=O)N(CCCO)C2OC2N3C)cn1 |
| InChI | InChI=1S/C24H26ClN5O4/c1-15-4-5-17(12-26-15)14-33-24-27-20-19(30(24)13-16-6-8-18(25)9-7-16)21(32)29(10-3-11-31)23-22(34-23)28(20)2/h4-9,12,22-23,31H,3,10-11,13-14H2,1-2H3 |
| InChIKey | PJUDYNHUBRYSSL-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 96.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.96 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|