About 8-(3-chlorophenoxy)-7-[(4-chlorophenyl)methyl]-1-(3-hydroxypropyl)-3H-purine-2,6-dione
8-(3-chlorophenoxy)-7-[(4-chlorophenyl)methyl]-1-(3-hydroxypropyl)-3H-purine-2,6-dione (PubChem CID 135269341) has the molecular formula C21H18Cl2N4O4
and a molecular weight of 461.31 g/mol. Its IUPAC name is 8-(3-chlorophenoxy)-7-[(4-chlorophenyl)methyl]-1-(3-hydroxypropyl)-3H-purine-2,6-dione.
Molecular Properties
| Compound Name | 8-(3-chlorophenoxy)-7-[(4-chlorophenyl)methyl]-1-(3-hydroxypropyl)-3H-purine-2,6-dione |
| PubChem CID | 135269341 |
| Molecular Formula | C21H18Cl2N4O4 |
| Molecular Weight | 461.31 g/mol |
| Exact Mass | 460.07 |
| IUPAC Name | 8-(3-chlorophenoxy)-7-[(4-chlorophenyl)methyl]-1-(3-hydroxypropyl)-3H-purine-2,6-dione |
| SMILES | O=c1[nH]c2nc(Oc3cccc(Cl)c3)n(Cc3ccc(Cl)cc3)c2c(=O)n1CCCO |
| InChI | InChI=1S/C21H18Cl2N4O4/c22-14-7-5-13(6-8-14)12-27-17-18(24-20(30)26(19(17)29)9-2-10-28)25-21(27)31-16-4-1-3-15(23)11-16/h1,3-8,11,28H,2,9-10,12H2,(H,24,30) |
| InChIKey | ZYMPEBDEVDZMHN-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 102.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 461.31 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 8-(3-chlorophenoxy)-7-[(4-chlorophenyl)methyl]-1-(3-hydroxypropyl)-3H-purine-2,6-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-(3-chlorophenoxy)-7-[(4-chlorophenyl)methyl]-1-(3-hydroxypropyl)-3H-purine-2,6-dione?
The IUPAC name of 8-(3-chlorophenoxy)-7-[(4-chlorophenyl)methyl]-1-(3-hydroxypropyl)-3H-purine-2,6-dione (CID 135269341) is 8-(3-chlorophenoxy)-7-[(4-chlorophenyl)methyl]-1-(3-hydroxypropyl)-3H-purine-2,6-dione.
What is the SMILES notation for 8-(3-chlorophenoxy)-7-[(4-chlorophenyl)methyl]-1-(3-hydroxypropyl)-3H-purine-2,6-dione?
The canonical SMILES for 8-(3-chlorophenoxy)-7-[(4-chlorophenyl)methyl]-1-(3-hydroxypropyl)-3H-purine-2,6-dione is O=c1[nH]c2nc(Oc3cccc(Cl)c3)n(Cc3ccc(Cl)cc3)c2c(=O)n1CCCO.
What is the InChIKey of 8-(3-chlorophenoxy)-7-[(4-chlorophenyl)methyl]-1-(3-hydroxypropyl)-3H-purine-2,6-dione?
The InChIKey is ZYMPEBDEVDZMHN-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H18Cl2N4O4/c22-14-7-5-13(6-8-14)12-27-17-18(24-20(30)26(19(17)29)9-2-10-28)25-21(27)31-16-4-1-3-15(23)11-16/h1,3-8,11,28H,2,9-10,12H2,(H,24,30).
What are the key properties of 8-(3-chlorophenoxy)-7-[(4-chlorophenyl)methyl]-1-(3-hydroxypropyl)-3H-purine-2,6-dione?
8-(3-chlorophenoxy)-7-[(4-chlorophenyl)methyl]-1-(3-hydroxypropyl)-3H-purine-2,6-dione has a molecular weight of 461.31 g/mol, XLogP of 3.42, 7 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 8-(3-chlorophenoxy)-7-[(4-chlorophenyl)methyl]-1-(3-hydroxypropyl)-3H-purine-2,6-dione is sourced from PubChem (CID 135269341), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).