C17H26N2 — CID 135269780
(2Z,4E)-2-N-[1-[(1S)-cyclohexa-2,4-dien-1-yl]butan-2-yl]hepta-2,4,6-triene-2,5-diamine (PubChem CID 135269780) has the molecular formula C17H26N2 and a molecular weight of 258.41 g/mol. Its IUPAC name is (2Z,4E)-2-N-[1-[(1S)-cyclohexa-2,4-dien-1-yl]butan-2-yl]hepta-2,4,6-triene-2,5-diamine.
| Compound Name | (2Z,4E)-2-N-[1-[(1S)-cyclohexa-2,4-dien-1-yl]butan-2-yl]hepta-2,4,6-triene-2,5-diamine |
|---|---|
| PubChem CID | 135269780 |
| Molecular Formula | C17H26N2 |
| Molecular Weight | 258.41 g/mol |
| Exact Mass | 258.21 |
| IUPAC Name | (2Z,4E)-2-N-[1-[(1S)-cyclohexa-2,4-dien-1-yl]butan-2-yl]hepta-2,4,6-triene-2,5-diamine |
| SMILES | C=C/C(N)=C\C=C(\C)NC(CC)C[C@H]1C=CC=CC1 |
| InChI | InChI=1S/C17H26N2/c1-4-16(18)12-11-14(3)19-17(5-2)13-15-9-7-6-8-10-15/h4,6-9,11-12,15,17,19H,1,5,10,13,18H2,2-3H3/b14-11-,16-12+/t15-,17?/m0/s1 |
| InChIKey | PXAALCMZSCUUDD-BFRNTNMJSA-N |
| XLogP | 3.81 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.41 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|