C12H19N — CID 135270020
(4E,5Z,7Z)-4-ethylidene-N-methylnona-5,7-dien-3-imine (PubChem CID 135270020) has the molecular formula C12H19N and a molecular weight of 177.29 g/mol. Its IUPAC name is (4E,5Z,7Z)-4-ethylidene-N-methylnona-5,7-dien-3-imine.
| Compound Name | (4E,5Z,7Z)-4-ethylidene-N-methylnona-5,7-dien-3-imine |
|---|---|
| PubChem CID | 135270020 |
| Molecular Formula | C12H19N |
| Molecular Weight | 177.29 g/mol |
| Exact Mass | 177.15 |
| IUPAC Name | (4E,5Z,7Z)-4-ethylidene-N-methylnona-5,7-dien-3-imine |
| SMILES | C/C=C\C=C/C(=C\C)/C(CC)=N/C |
| InChI | InChI=1S/C12H19N/c1-5-8-9-10-11(6-2)12(7-3)13-4/h5-6,8-10H,7H2,1-4H3/b8-5-,10-9-,11-6+,13-12+ |
| InChIKey | KCZAJWMJFFUEGK-GCPUVVTBSA-N |
| XLogP | 3.55 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.29 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|