C22H20F2N6O — CID 135270347
3-[5-[2-fluoro-4-[(2-fluoroethylamino)methyl]phenyl]-1,3,4-oxadiazol-2-yl]-5-(4-methylphenyl)pyrazin-2-amine (PubChem CID 135270347) has the molecular formula C22H20F2N6O and a molecular weight of 422.44 g/mol. Its IUPAC name is 3-[5-[2-fluoro-4-[(2-fluoroethylamino)methyl]phenyl]-1,3,4-oxadiazol-2-yl]-5-(4-methylphenyl)pyrazin-2-amine.
| Compound Name | 3-[5-[2-fluoro-4-[(2-fluoroethylamino)methyl]phenyl]-1,3,4-oxadiazol-2-yl]-5-(4-methylphenyl)pyrazin-2-amine |
|---|---|
| PubChem CID | 135270347 |
| Molecular Formula | C22H20F2N6O |
| Molecular Weight | 422.44 g/mol |
| Exact Mass | 422.17 |
| IUPAC Name | 3-[5-[2-fluoro-4-[(2-fluoroethylamino)methyl]phenyl]-1,3,4-oxadiazol-2-yl]-5-(4-methylphenyl)pyrazin-2-amine |
| SMILES | Cc1ccc(-c2cnc(N)c(-c3nnc(-c4ccc(CNCCF)cc4F)o3)n2)cc1 |
| InChI | InChI=1S/C22H20F2N6O/c1-13-2-5-15(6-3-13)18-12-27-20(25)19(28-18)22-30-29-21(31-22)16-7-4-14(10-17(16)24)11-26-9-8-23/h2-7,10,12,26H,8-9,11H2,1H3,(H2,25,27) |
| InChIKey | KPDBZPDCHYHUED-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 102.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.44 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|