About (2S)-3,4-diethyl-2-methylsulfanylpyrrolidine
(2S)-3,4-diethyl-2-methylsulfanylpyrrolidine (PubChem CID 135270621) has the molecular formula C9H19NS
and a molecular weight of 173.32 g/mol. Its IUPAC name is (2S)-3,4-diethyl-2-methylsulfanylpyrrolidine.
Molecular Properties
| Compound Name | (2S)-3,4-diethyl-2-methylsulfanylpyrrolidine |
| PubChem CID | 135270621 |
| Molecular Formula | C9H19NS |
| Molecular Weight | 173.32 g/mol |
| Exact Mass | 173.12 |
| IUPAC Name | (2S)-3,4-diethyl-2-methylsulfanylpyrrolidine |
| SMILES | CCC1CN[C@@H](SC)C1CC |
| InChI | InChI=1S/C9H19NS/c1-4-7-6-10-9(11-3)8(7)5-2/h7-10H,4-6H2,1-3H3/t7?,8?,9-/m0/s1 |
| InChIKey | GPNJQTQCQOOMRY-HACHORDNSA-N |
| XLogP | 2.33 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 173.32 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (2S)-3,4-diethyl-2-methylsulfanylpyrrolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-3,4-diethyl-2-methylsulfanylpyrrolidine?
The IUPAC name of (2S)-3,4-diethyl-2-methylsulfanylpyrrolidine (CID 135270621) is (2S)-3,4-diethyl-2-methylsulfanylpyrrolidine.
What is the SMILES notation for (2S)-3,4-diethyl-2-methylsulfanylpyrrolidine?
The canonical SMILES for (2S)-3,4-diethyl-2-methylsulfanylpyrrolidine is CCC1CN[C@@H](SC)C1CC.
What is the InChIKey of (2S)-3,4-diethyl-2-methylsulfanylpyrrolidine?
The InChIKey is GPNJQTQCQOOMRY-HACHORDNSA-N. The full InChI is InChI=1S/C9H19NS/c1-4-7-6-10-9(11-3)8(7)5-2/h7-10H,4-6H2,1-3H3/t7?,8?,9-/m0/s1.
What are the key properties of (2S)-3,4-diethyl-2-methylsulfanylpyrrolidine?
(2S)-3,4-diethyl-2-methylsulfanylpyrrolidine has a molecular weight of 173.32 g/mol, XLogP of 2.33, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-3,4-diethyl-2-methylsulfanylpyrrolidine is sourced from PubChem (CID 135270621), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).